CAS 13148-78-2 is the registry number for 1,4-Diphenyl-1H-1,2,3-triazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
1,4-diphenyltriazole (CAS 13148-78-2) is a chemical compound with the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. IUPAC name: 1,4-diphenyltriazole. InChIKey: UIXYUQXWIFEYBN-UHFFFAOYSA-N.
| Molecular formula | C14H11N3 |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | 1,4-diphenyltriazole |
| InChIKey | UIXYUQXWIFEYBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN(N=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)