CAS 5174-94-7 is the registry number for 3-Phenyl-1,8-naphthyridin-2-amine. Offered by: TRC. Available pack sizes: 1g.
3-phenyl-1,8-naphthyridin-2-amine (CAS 5174-94-7) is a chemical compound with the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. IUPAC name: 3-phenyl-1,8-naphthyridin-2-amine. InChIKey: USUJXARHDURNRZ-UHFFFAOYSA-N.
| Molecular formula | C14H11N3 |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | 3-phenyl-1,8-naphthyridin-2-amine |
| InChIKey | USUJXARHDURNRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C3C(=C2)C=CC=N3)N |
Computed by PubChem (NCBI)