cas: 36094-04-9 — see every product listed under this CAS number, including other names
2-Phenylthiazole-4-carbonyl chloride 97% (CAS 36094-04-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A963966-100mg |
| cas | 36094-04-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 581.75 Pln | |
| Ambeed | 250mg | 687.44 Pln | |
| Ambeed | 1g | 1621.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A963966 |
2-phenyl-1,3-thiazole-4-carbonyl chloride (CAS 36094-04-9) is a chemical compound with the molecular formula C10H6ClNOS and a molecular weight of 223.68 g/mol. IUPAC name: 2-phenyl-1,3-thiazole-4-carbonyl chloride. InChIKey: ZZFOIDMEHXGBKS-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNOS |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 2-phenyl-1,3-thiazole-4-carbonyl chloride |
| InChIKey | ZZFOIDMEHXGBKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)C(=O)Cl |
Computed by PubChem (NCBI)