cas: 750640-97-2 — see every product listed under this CAS number, including other names
2-Piperidin-3-yl-1,3-benzothiazole, HCl, 98%, 98% (CAS 750640-97-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0LH-100mg |
| cas | 750640-97-2 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 606.80 Pln | |
| Chemat | 1g | 1346.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-piperidin-3-yl-1,3-benzothiazole (CAS 750640-97-2) is a chemical compound with the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. IUPAC name: 2-piperidin-3-yl-1,3-benzothiazole. InChIKey: PXPKASSSZWCUJE-UHFFFAOYSA-N.
| Molecular formula | C12H14N2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 2-piperidin-3-yl-1,3-benzothiazole |
| InChIKey | PXPKASSSZWCUJE-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)