cas: 85997-30-4 — see every product listed under this CAS number, including other names
2-Propenoic acid, 2-methyl-, 3-(4-pyridinyl)propyl ester, 95%+, 95%+ (CAS 85997-30-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPH7-100mg |
| cas | 85997-30-4 |
| size | 100mg |
| availability | 5.6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1442.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
3-pyridin-4-ylpropyl 2-methylprop-2-enoate (CAS 85997-30-4) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 3-pyridin-4-ylpropyl 2-methylprop-2-enoate. InChIKey: JIOVONQDCZYUSM-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 3-pyridin-4-ylpropyl 2-methylprop-2-enoate |
| InChIKey | JIOVONQDCZYUSM-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCCC1=CC=NC=C1 |
Computed by PubChem (NCBI)