cas: 23945-50-8 — see every product listed under this CAS number, including other names
2-THIOURACIL-5-CARBOXYLIC ACID, 98% (CAS 23945-50-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F513562-250MG |
| cas | 23945-50-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 409.25 Pln | |
| Fluorochem | 10g | 737.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid (CAS 23945-50-8) is a chemical compound with the molecular formula C5H4N2O3S and a molecular weight of 172.16 g/mol. IUPAC name: 4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid. InChIKey: XKHWTDCFQVKNHW-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3S |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | 4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid |
| InChIKey | XKHWTDCFQVKNHW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=S)N1)C(=O)O |
Computed by PubChem (NCBI)