cas: 23945-50-8 — see every product listed under this CAS number, including other names
5-Carboxy-2-thiouracil, 99.87% (CAS 23945-50-8) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W052750-5 g |
| cas | 23945-50-8 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 570.47 Pln | |
| MedChemExpress | 10 g | 839.82 Pln | |
| MedChemExpress | 1 g | 310.40 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.87% |
4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid (CAS 23945-50-8) is a chemical compound with the molecular formula C5H4N2O3S and a molecular weight of 172.16 g/mol. IUPAC name: 4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid. InChIKey: XKHWTDCFQVKNHW-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3S |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | 4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid |
| InChIKey | XKHWTDCFQVKNHW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=S)N1)C(=O)O |
Computed by PubChem (NCBI)