cas: 135-73-9 — see every product listed under this CAS number, including other names
2-bromo-1-(4-phenylphenyl)ethan-1-one, 98% (CAS 135-73-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F358275-1G |
| cas | 135-73-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 195.78 Pln | |
| Fluorochem | 25g | 331.15 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-1-(4-phenylphenyl)ethanone (CAS 135-73-9) is a chemical compound with the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. IUPAC name: 2-bromo-1-(4-phenylphenyl)ethanone. InChIKey: KGHGZRVXCKCJGX-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | 2-bromo-1-(4-phenylphenyl)ethanone |
| InChIKey | KGHGZRVXCKCJGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)CBr |
Computed by PubChem (NCBI)