cas: 731002-59-8 — see every product listed under this CAS number, including other names
2-chloro-4-(trifluoromethyl)pyridin-3-ol, 96.10%, 96.10% (CAS 731002-59-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUWP-10mg |
| cas | 731002-59-8 |
| size | 10mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 434.00 Pln | |
| Chemat | 25mg | 693.20 Pln |
| purity | 96.10% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4-(trifluoromethyl)pyridin-3-ol (CAS 731002-59-8) is a chemical compound with the molecular formula C6H3ClF3NO and a molecular weight of 197.54 g/mol. IUPAC name: 2-chloro-4-(trifluoromethyl)pyridin-3-ol. InChIKey: FWUISHIPDMLMDO-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO |
|---|---|
| Molecular weight | 197.54 g/mol |
| IUPAC name | 2-chloro-4-(trifluoromethyl)pyridin-3-ol |
| InChIKey | FWUISHIPDMLMDO-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(F)(F)F)O)Cl |
Computed by PubChem (NCBI)