cas: 1227602-42-7 — see every product listed under this CAS number, including other names
2-chloro-6-(trifluoromethyl)-1,4-dihydropyridin-4-one, 98% (CAS 1227602-42-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631742-250MG |
| cas | 1227602-42-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1002.79 Pln | |
| Fluorochem | 1g | 2424.16 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-6-(trifluoromethyl)-1H-pyridin-4-one (CAS 1227602-42-7) is a chemical compound with the molecular formula C6H3ClF3NO and a molecular weight of 197.54 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)-1H-pyridin-4-one. InChIKey: IWHZJFOEGCEWAS-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO |
|---|---|
| Molecular weight | 197.54 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)-1H-pyridin-4-one |
| InChIKey | IWHZJFOEGCEWAS-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=CC1=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)