cas: 1408074-81-6 — see every product listed under this CAS number, including other names
2-tert-Butyl 6-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate, 98.42% (CAS 1408074-81-6) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 250 mg, 500 mg, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W059942-1 g |
| cas | 1408074-81-6 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 1392.46 Pln | |
| MedChemExpress | 250 mg | 742.30 Pln | |
| MedChemExpress | 500 mg | 1007.00 Pln | |
| MedChemExpress | 100 mg | 477.59 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.42% |
2-O-tert-butyl 6-O-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate (CAS 1408074-81-6) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 2-O-tert-butyl 6-O-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate. InChIKey: FZDJDEXABKVIDA-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 2-O-tert-butyl 6-O-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate |
| InChIKey | FZDJDEXABKVIDA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)C(=O)OC |
Computed by PubChem (NCBI)