CAS 1408074-81-6 appears in our catalog under these names: 2-tert-Butyl 6-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate, 95%, 2-tert-Butyl 6-Methyl 2-azaspiro(3.3)heptane-2,6-dicarboxylate, 2-tert-butyl 6-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate 98%, 2-tert-Butyl 6-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate, 98%, 98%, 2-tert-Butyl 6-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate, 98.42%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g, 10g, 1 g, 250 mg.
2-O-tert-butyl 6-O-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate (CAS 1408074-81-6) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 2-O-tert-butyl 6-O-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate. InChIKey: FZDJDEXABKVIDA-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 2-O-tert-butyl 6-O-methyl 2-azaspiro[3.3]heptane-2,6-dicarboxylate |
| InChIKey | FZDJDEXABKVIDA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)C(=O)OC |
Computed by PubChem (NCBI)