cas: 1188335-77-4 — see every product listed under this CAS number, including other names
2-tert-Butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 97% (CAS 1188335-77-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F623807-100MG |
| cas | 1188335-77-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1080.89 Pln | |
| Fluorochem | 250mg | 1799.38 Pln | |
| Fluorochem | 1g | 4824.36 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1188335-77-4) is a chemical compound with the molecular formula C16H25BO3 and a molecular weight of 276.2 g/mol. IUPAC name: 2-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: XSUMAENGLSIWFW-UHFFFAOYSA-N.
| Molecular formula | C16H25BO3 |
|---|---|
| Molecular weight | 276.2 g/mol |
| IUPAC name | 2-tert-butyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | XSUMAENGLSIWFW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)O)C(C)(C)C |
Computed by PubChem (NCBI)