CAS 21038-63-1 appears in our catalog under these names: 2H-Pyrido(2,3-d)(1,3)oxazine-2,4(1H)-dione, 1H-Pyrido[2,3-d][1,3]oxazine-2,4-dione, 97%, 97%, 1H-Pyrido[2,3-d][1,3]oxazine-2,4-dione, 97%, 2H-Pyrido[2,3-d][1,3]oxazine-2,4(1H)-dione, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 5g.
1H-pyrido[2,3-d][1,3]oxazine-2,4-dione (CAS 21038-63-1) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 1H-pyrido[2,3-d][1,3]oxazine-2,4-dione. InChIKey: LZWZQYVPLLPAGX-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 1H-pyrido[2,3-d][1,3]oxazine-2,4-dione |
| InChIKey | LZWZQYVPLLPAGX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=O)OC2=O)N=C1 |
Computed by PubChem (NCBI)