CAS 3320-86-3 appears in our catalog under these names: 2-Nitrophenyl isocyanate, 95%, 2-Nitrophenylisocyanate, 98%, 2-Nitrophenyl isocyanate, 99%, 1-Isocyanato-2-nitrobenzene, 98%(HPLC),RG. Offered by: Combi-blocks, Chemat Brand, Thermo Scientific (Acros), Sigma-Aldrich, Fluorochem. Available pack sizes: 5g, 1g, on request, 25g.
1-isocyanato-2-nitrobenzene (CAS 3320-86-3) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 1-isocyanato-2-nitrobenzene. InChIKey: JRVZITODZAQRQM-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 1-isocyanato-2-nitrobenzene |
| InChIKey | JRVZITODZAQRQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N=C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)