CAS 39835-28-4 appears in our catalog under these names: 5-Nitro-1,2-benzisoxazole, 95%, 5-Nitro-1,2-benzisoxazole 97%, 5-Nitro-1,2-benzisoxazole, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
5-nitro-1,2-benzoxazole (CAS 39835-28-4) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 5-nitro-1,2-benzoxazole. InChIKey: TWOYWCWKYDYTIP-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 5-nitro-1,2-benzoxazole |
| InChIKey | TWOYWCWKYDYTIP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C=NO2 |
Computed by PubChem (NCBI)