CAS 1368353-68-7 is the registry number for Isoxazolo[3,4-b]pyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
[1,2]oxazolo[3,4-b]pyridine-3-carboxylic acid (CAS 1368353-68-7) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: [1,2]oxazolo[3,4-b]pyridine-3-carboxylic acid. InChIKey: BODGDGQIWADRBS-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | [1,2]oxazolo[3,4-b]pyridine-3-carboxylic acid |
| InChIKey | BODGDGQIWADRBS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(ON=C2N=C1)C(=O)O |
Computed by PubChem (NCBI)