cas: 50670-78-5 — see every product listed under this CAS number, including other names
3',4'-Dichloro-[1,1'-biphenyl]-4-carbaldehyde 98% (CAS 50670-78-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A137425-250mg |
| cas | 50670-78-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A137425 |
4-(3,4-dichlorophenyl)benzaldehyde (CAS 50670-78-5) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)benzaldehyde. InChIKey: OMFFUMDRNYYSFR-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)benzaldehyde |
| InChIKey | OMFFUMDRNYYSFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)