cas: 24448-73-5 — see every product listed under this CAS number, including other names
3',4'-Dichlorosalicylanilide, >95.0%(GC) (CAS 24448-73-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D1077-1G |
| cas | 24448-73-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 733.00 Pln | |
| TCI | 5g | 2660.56 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
N-(3,4-dichlorophenyl)-2-hydroxybenzamide (CAS 24448-73-5) is a chemical compound with the molecular formula C13H9Cl2NO2 and a molecular weight of 282.12 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-2-hydroxybenzamide. InChIKey: XWZCOIHEGFREJR-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO2 |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-2-hydroxybenzamide |
| InChIKey | XWZCOIHEGFREJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC(=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)