CAS 54255-56-0 is the registry number for 2,4-Dichloro-N-(2-hydroxyphenyl)benzamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-N-(2-hydroxyphenyl)benzamide (CAS 54255-56-0) is a chemical compound with the molecular formula C13H9Cl2NO2 and a molecular weight of 282.12 g/mol. IUPAC name: 2,4-dichloro-N-(2-hydroxyphenyl)benzamide. InChIKey: HGNVTWLOUXXFJN-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO2 |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | 2,4-dichloro-N-(2-hydroxyphenyl)benzamide |
| InChIKey | HGNVTWLOUXXFJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)C2=C(C=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)