CAS 1361876-17-6 is the registry number for Methyl 6-(3,5-dichlorophenyl)pyridine-2-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl 6-(3,5-dichlorophenyl)pyridine-2-carboxylate (CAS 1361876-17-6) is a chemical compound with the molecular formula C13H9Cl2NO2 and a molecular weight of 282.12 g/mol. IUPAC name: methyl 6-(3,5-dichlorophenyl)pyridine-2-carboxylate. InChIKey: OALFBMVBWDYQDN-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO2 |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | methyl 6-(3,5-dichlorophenyl)pyridine-2-carboxylate |
| InChIKey | OALFBMVBWDYQDN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=N1)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)