CAS 1346691-98-2 is the registry number for Methyl 5-(3,5-dichlorophenyl)pyridine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 5-(3,5-dichlorophenyl)pyridine-3-carboxylate (CAS 1346691-98-2) is a chemical compound with the molecular formula C13H9Cl2NO2 and a molecular weight of 282.12 g/mol. IUPAC name: methyl 5-(3,5-dichlorophenyl)pyridine-3-carboxylate. InChIKey: XTZJNKHBQDNDOG-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO2 |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | methyl 5-(3,5-dichlorophenyl)pyridine-3-carboxylate |
| InChIKey | XTZJNKHBQDNDOG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=CC(=C1)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)