Products 132719-10-9
CAS 132719-10-9 appears in our catalog under these names: 3',5'-Dimethyl-2,2,2-trifluoroacetophenone, 95+%, 3',5'-Dimethyl-2,2,2-trifluoroacetophenone, ≥95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 100mg, 10g, 5g, 500mg.
1-(3,5-dimethylphenyl)-2,2,2-trifluoroethanone (CAS 132719-10-9) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)-2,2,2-trifluoroethanone. InChIKey: SOGZINXNLJBXMX-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | SOGZINXNLJBXMX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)