CAS 932395-40-9 is the registry number for (E)-2-(Trifluoromethyl)vinyl benzyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g.
[(E)-3,3,3-trifluoroprop-1-enoxy]methylbenzene (CAS 932395-40-9) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: [(E)-3,3,3-trifluoroprop-1-enoxy]methylbenzene. InChIKey: VQPAEZXUOGRKIL-VOTSOKGWSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | [(E)-3,3,3-trifluoroprop-1-enoxy]methylbenzene |
| InChIKey | VQPAEZXUOGRKIL-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)CO/C=C/C(F)(F)F |
Computed by PubChem (NCBI)