CAS 134418-70-5 is the registry number for 1,1,1-Trifluoro-2-phenyl-3-buten-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg.
1,1,1-trifluoro-2-phenylbut-3-en-2-ol (CAS 134418-70-5) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: 1,1,1-trifluoro-2-phenylbut-3-en-2-ol. InChIKey: QZTXJLLJGFCKCH-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 1,1,1-trifluoro-2-phenylbut-3-en-2-ol |
| InChIKey | QZTXJLLJGFCKCH-UHFFFAOYSA-N |
| SMILES | C=CC(C1=CC=CC=C1)(C(F)(F)F)O |
Computed by PubChem (NCBI)