CAS 128271-44-3 is the registry number for 3,3,3-Trifluoro-2-methyl-1-phenylpropan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,3,3-trifluoro-2-methyl-1-phenylpropan-1-one (CAS 128271-44-3) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: 3,3,3-trifluoro-2-methyl-1-phenylpropan-1-one. InChIKey: FFSQUPZKCFPFEM-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-methyl-1-phenylpropan-1-one |
| InChIKey | FFSQUPZKCFPFEM-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)