cas: 478647-00-6 — see every product listed under this CAS number, including other names
3'-Chloro-(1,1'-biphenyl)-4-sulfonyl chloride, 95+% (CAS 478647-00-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A868741-5g |
| cas | 478647-00-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8663.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(3-chlorophenyl)benzenesulfonyl chloride (CAS 478647-00-6) is a chemical compound with the molecular formula C12H8Cl2O2S and a molecular weight of 287.2 g/mol. IUPAC name: 4-(3-chlorophenyl)benzenesulfonyl chloride. InChIKey: FVELIXWAKJVRDG-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O2S |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 4-(3-chlorophenyl)benzenesulfonyl chloride |
| InChIKey | FVELIXWAKJVRDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)