cas: 811842-42-9 — see every product listed under this CAS number, including other names
3'-Trifluoromethylbiphenyl-3-ylaminehydrochloride (CAS 811842-42-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014345-100MG |
| cas | 811842-42-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1101.71 Pln |
| delivery time | 2-3 weeks |
|---|
3-[3-(trifluoromethyl)phenyl]aniline;hydrochloride (CAS 811842-42-9) is a chemical compound with the molecular formula C13H11ClF3N and a molecular weight of 273.68 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]aniline;hydrochloride. InChIKey: VQSYGRWBFWQJIS-UHFFFAOYSA-N.
| Molecular formula | C13H11ClF3N |
|---|---|
| Molecular weight | 273.68 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]aniline;hydrochloride |
| InChIKey | VQSYGRWBFWQJIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)