CAS 811842-42-9 appears in our catalog under these names: 3-[3-(Trifluoromethyl)phenyl]aniline hydrochloride, 98%, 3'-(Trifluoromethyl)-[1,1'-biphenyl]-3-amine hydrochloride, 98%, 98%, 3'-Trifluoromethylbiphenyl-3-ylaminehydrochloride. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
3-[3-(trifluoromethyl)phenyl]aniline;hydrochloride (CAS 811842-42-9) is a chemical compound with the molecular formula C13H11ClF3N and a molecular weight of 273.68 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]aniline;hydrochloride. InChIKey: VQSYGRWBFWQJIS-UHFFFAOYSA-N.
| Molecular formula | C13H11ClF3N |
|---|---|
| Molecular weight | 273.68 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]aniline;hydrochloride |
| InChIKey | VQSYGRWBFWQJIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)