CAS 1197232-65-7 appears in our catalog under these names: 3'-(Trifluoromethyl)-[1,1'-biphenyl]-2-amine hydrochloride, 96%, 3'-(Trifluoromethyl)-(1,1'-biphenyl)-2-amine hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-[3-(trifluoromethyl)phenyl]aniline;hydrochloride (CAS 1197232-65-7) is a chemical compound with the molecular formula C13H11ClF3N and a molecular weight of 273.68 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]aniline;hydrochloride. InChIKey: ZFWMQBKNSLEWSN-UHFFFAOYSA-N.
| Molecular formula | C13H11ClF3N |
|---|---|
| Molecular weight | 273.68 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]aniline;hydrochloride |
| InChIKey | ZFWMQBKNSLEWSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC=C2)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)