CAS 811842-57-6 is the registry number for 2'-(Trifluoromethyl)-[1,1'-biphenyl]-4-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-(trifluoromethyl)phenyl]aniline;hydrochloride (CAS 811842-57-6) is a chemical compound with the molecular formula C13H11ClF3N and a molecular weight of 273.68 g/mol. IUPAC name: 4-[2-(trifluoromethyl)phenyl]aniline;hydrochloride. InChIKey: JFTXGSRGFAVEGC-UHFFFAOYSA-N.
| Molecular formula | C13H11ClF3N |
|---|---|
| Molecular weight | 273.68 g/mol |
| IUPAC name | 4-[2-(trifluoromethyl)phenyl]aniline;hydrochloride |
| InChIKey | JFTXGSRGFAVEGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)