cas: 224168-68-7 — see every product listed under this CAS number, including other names
3(S)-Iodomethyl-pyrrolidine-1-carboxylic acid tert-butyl ester, 98% (CAS 224168-68-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F600292-100MG |
| cas | 224168-68-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1664.02 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S)-3-(iodomethyl)pyrrolidine-1-carboxylate (CAS 224168-68-7) is a chemical compound with the molecular formula C10H18INO2 and a molecular weight of 311.16 g/mol. IUPAC name: tert-butyl (3S)-3-(iodomethyl)pyrrolidine-1-carboxylate. InChIKey: DNUFVBGZKFHSDQ-MRVPVSSYSA-N.
| Molecular formula | C10H18INO2 |
|---|---|
| Molecular weight | 311.16 g/mol |
| IUPAC name | tert-butyl (3S)-3-(iodomethyl)pyrrolidine-1-carboxylate |
| InChIKey | DNUFVBGZKFHSDQ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)CI |
Computed by PubChem (NCBI)