cas: 2417-04-1 — see every product listed under this CAS number, including other names
3,3',5,5'-Tetramethyl-1,1'-biphenyl-4,4'-diol, 98%, 98% (CAS 2417-04-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140TS-1g |
| cas | 2417-04-1 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 112.40 Pln | |
| Chemat | 100g | 150.80 Pln | |
| Chemat | 250g | 242.00 Pln | |
| Chemat | 500g | 422.40 Pln | |
| Chemat | 1kg | 698.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenol (CAS 2417-04-1) is a chemical compound with the molecular formula C16H18O2 and a molecular weight of 242.31 g/mol. IUPAC name: 4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenol. InChIKey: YGYPMFPGZQPETF-UHFFFAOYSA-N.
| Molecular formula | C16H18O2 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | 4-(4-hydroxy-3,5-dimethylphenyl)-2,6-dimethylphenol |
| InChIKey | YGYPMFPGZQPETF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)C)C2=CC(=C(C(=C2)C)O)C |
Computed by PubChem (NCBI)