CAS 26567-10-2 appears in our catalog under these names: 3,3',5,5'-Tetramethyl-2,2'-biphenol, 95%, 3,3',5,5'–Tetramethyl–(1,1'–biphenyl)–2,2'–diol, 3,3',5,5'-Tetramethyl-[1,1'-biphenyl]-2,2'-diol, 97%, 97%, 3,3',5,5'-TETRAMETHYL-[1,1'-BIPHENYL]-2,2'-DIOL, 98%, 3,3',5,5'-Tetramethyl-[1,1'-biphenyl]-2,2'-diol, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 500mg, 250mg, 1g.
2-(2-hydroxy-3,5-dimethylphenyl)-4,6-dimethylphenol (CAS 26567-10-2) is a chemical compound with the molecular formula C16H18O2 and a molecular weight of 242.31 g/mol. IUPAC name: 2-(2-hydroxy-3,5-dimethylphenyl)-4,6-dimethylphenol. InChIKey: XBDTZNMRTRPDKH-UHFFFAOYSA-N.
| Molecular formula | C16H18O2 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | 2-(2-hydroxy-3,5-dimethylphenyl)-4,6-dimethylphenol |
| InChIKey | XBDTZNMRTRPDKH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C2=CC(=CC(=C2O)C)C)O)C |
Computed by PubChem (NCBI)