CAS 622-22-0 appears in our catalog under these names: Ethylene glycol dibenzyl ether, 95%, Ethylene Glycol Dibenzyl Ether, Ethylene Glycol Dibenzyl Ether, >95.0%(GC), 1,2-bis(benzyloxy)ethane, 95%, 95%, 1,2-Bis(benzyloxy)ethane, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Ambeed. Available pack sizes: 25g, 100g, 1g, 5g, 5ml, 25ml.
2-phenylmethoxyethoxymethylbenzene (CAS 622-22-0) is a chemical compound with the molecular formula C16H18O2 and a molecular weight of 242.31 g/mol. IUPAC name: 2-phenylmethoxyethoxymethylbenzene. InChIKey: FPFHYKOBYMYVAN-UHFFFAOYSA-N.
| Molecular formula | C16H18O2 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | 2-phenylmethoxyethoxymethylbenzene |
| InChIKey | FPFHYKOBYMYVAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOCC2=CC=CC=C2 |
Computed by PubChem (NCBI)