CAS 14151-63-4 appears in our catalog under these names: Phenol, 4-[1-(4-hydroxyphenyl)-1-methylethyl]-2-methyl-, 95%, 2-(4-hydroxy-3-methylphenyl)-2-(4'-hydroxyphenyl)propane, 95%, 95%, 3–Methyl–4,4dihydroxydiphenyl–2,2–propane. Offered by: Combi-blocks, Chemat, GLPBio. Available pack sizes: 100mg, 250mg, 25mg, 1g.
4-[2-(4-hydroxyphenyl)propan-2-yl]-2-methylphenol (CAS 14151-63-4) is a chemical compound with the molecular formula C16H18O2 and a molecular weight of 242.31 g/mol. IUPAC name: 4-[2-(4-hydroxyphenyl)propan-2-yl]-2-methylphenol. InChIKey: HFRAJYYHALXFLZ-UHFFFAOYSA-N.
| Molecular formula | C16H18O2 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | 4-[2-(4-hydroxyphenyl)propan-2-yl]-2-methylphenol |
| InChIKey | HFRAJYYHALXFLZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C)(C)C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)