cas: 1450835-27-4 — see every product listed under this CAS number, including other names
3,3-Dimethyl-1,3-dihydroisobenzofurane-5-boronic Acid Pinacol Ester, >95%, >95% (CAS 1450835-27-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch130H5M-100mg |
| cas | 1450835-27-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 9366.80 Pln | |
| Chemat | 250mg | 11848.40 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
2-(3,3-dimethyl-1H-2-benzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1450835-27-4) is a chemical compound with the molecular formula C16H23BO3 and a molecular weight of 274.2 g/mol. IUPAC name: 2-(3,3-dimethyl-1H-2-benzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DWTYYBVEWWWQET-UHFFFAOYSA-N.
| Molecular formula | C16H23BO3 |
|---|---|
| Molecular weight | 274.2 g/mol |
| IUPAC name | 2-(3,3-dimethyl-1H-2-benzofuran-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DWTYYBVEWWWQET-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(COC3(C)C)C=C2 |
Computed by PubChem (NCBI)