cas: 16709-50-5 — see every product listed under this CAS number, including other names
3,4,5,6,7,8-hexahydrobenzo-2,9-dioxacyclododecin-1,10-dione, 97%, 97% (CAS 16709-50-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11B2SD-25mg |
| cas | 16709-50-5 |
| size | 25mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 338.00 Pln | |
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,10-dioxabicyclo[10.4.0]hexadeca-1(16),12,14-triene-2,11-dione (CAS 16709-50-5) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: 3,10-dioxabicyclo[10.4.0]hexadeca-1(16),12,14-triene-2,11-dione. InChIKey: DGMTZMCDDBNVPU-UHFFFAOYSA-N.
| Molecular formula | C14H16O4 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 3,10-dioxabicyclo[10.4.0]hexadeca-1(16),12,14-triene-2,11-dione |
| InChIKey | DGMTZMCDDBNVPU-UHFFFAOYSA-N |
| SMILES | C1CCCOC(=O)C2=CC=CC=C2C(=O)OCC1 |
Computed by PubChem (NCBI)