CAS 135110-69-9 appears in our catalog under these names: 7,8-Dihydroxyspiro[chromene-2,1'-cyclohexan]-4(3h)-one, 95%, 7,8–dihydroxyspiro(chromene–2,1'–cyclohexan)–4(3H)–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
7,8-dihydroxyspiro[3H-chromene-2,1'-cyclohexane]-4-one (CAS 135110-69-9) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: 7,8-dihydroxyspiro[3H-chromene-2,1'-cyclohexane]-4-one. InChIKey: VXZPJQXETDFJCN-UHFFFAOYSA-N.
| Molecular formula | C14H16O4 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 7,8-dihydroxyspiro[3H-chromene-2,1'-cyclohexane]-4-one |
| InChIKey | VXZPJQXETDFJCN-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CC(=O)C3=C(O2)C(=C(C=C3)O)O |
Computed by PubChem (NCBI)