cas: 886499-50-9 — see every product listed under this CAS number, including other names
3,4,5-Trifluorobenzenepropanoic acid, 95%, 95% (CAS 886499-50-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GR04-1g |
| cas | 886499-50-9 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 851.60 Pln | |
| Chemat | 10g | 1456.40 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 136.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(3,4,5-trifluorophenyl)propanoic acid (CAS 886499-50-9) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 3-(3,4,5-trifluorophenyl)propanoic acid. InChIKey: SJGZNFBPOANGAR-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 3-(3,4,5-trifluorophenyl)propanoic acid |
| InChIKey | SJGZNFBPOANGAR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)CCC(=O)O |
Computed by PubChem (NCBI)