CAS 78950-34-2 appears in our catalog under these names: 3-(Trifluoromethyl)phenyl acetate, 98%, 3-(Trifluoromethyl)phenyl acetate, 95+%, 3-(Trifluoromethyl)phenyl acetate, 95+%, 95+%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 25g, 10g.
[3-(trifluoromethyl)phenyl] acetate (CAS 78950-34-2) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: [3-(trifluoromethyl)phenyl] acetate. InChIKey: CBAIJJMMUDSHOD-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | [3-(trifluoromethyl)phenyl] acetate |
| InChIKey | CBAIJJMMUDSHOD-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1)C(F)(F)F |
Computed by PubChem (NCBI)