Products 886499-50-9
CAS 886499-50-9 appears in our catalog under these names: 3-(3,4,5-Trifluorophenyl)propionic acid, 95%, 3-(3,4,5-Trifluorophenyl)propanoic acid, 3,4,5-Trifluorobenzenepropanoic acid, 95%, 95%, 3-(3,4,5-Trifluorophenyl)propanoic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
3-(3,4,5-trifluorophenyl)propanoic acid (CAS 886499-50-9) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 3-(3,4,5-trifluorophenyl)propanoic acid. InChIKey: SJGZNFBPOANGAR-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 3-(3,4,5-trifluorophenyl)propanoic acid |
| InChIKey | SJGZNFBPOANGAR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)CCC(=O)O |
Computed by PubChem (NCBI)