Products 120985-68-4

CAS 120985-68-4 is the registry number for 5-Methyl-2-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-methyl-2-(trifluoromethyl)benzoic acid (CAS 120985-68-4) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 5-methyl-2-(trifluoromethyl)benzoic acid. InChIKey: YYEMDMKMHBXYPV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7F3O2
Molecular weight204.15 g/mol
IUPAC name5-methyl-2-(trifluoromethyl)benzoic acid
InChIKeyYYEMDMKMHBXYPV-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)