cas: 913472-55-6 — see every product listed under this CAS number, including other names
3,4,5-Trifluorobenzenesulfonamide 97% (CAS 913472-55-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A934499-1g |
| cas | 913472-55-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 832.06 Pln | |
| Ambeed | 10g | 1405.00 Pln | |
| Ambeed | 25g | 2817.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A934499 |
3,4,5-trifluorobenzenesulfonamide (CAS 913472-55-6) is a chemical compound with the molecular formula C6H4F3NO2S and a molecular weight of 211.16 g/mol. IUPAC name: 3,4,5-trifluorobenzenesulfonamide. InChIKey: BIAGBHUIRSMWRI-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2S |
|---|---|
| Molecular weight | 211.16 g/mol |
| IUPAC name | 3,4,5-trifluorobenzenesulfonamide |
| InChIKey | BIAGBHUIRSMWRI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)S(=O)(=O)N |
Computed by PubChem (NCBI)