cas: 913472-55-6 — see every product listed under this CAS number, including other names
3,4,5-Trifluorobenzenesulfonamide, 97%, 97% (CAS 913472-55-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117NRM-1g |
| cas | 913472-55-6 |
| size | 1g |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 746.00 Pln | |
| Chemat | 10g | 1274.00 Pln | |
| Chemat | 25g | 2450.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,4,5-trifluorobenzenesulfonamide (CAS 913472-55-6) is a chemical compound with the molecular formula C6H4F3NO2S and a molecular weight of 211.16 g/mol. IUPAC name: 3,4,5-trifluorobenzenesulfonamide. InChIKey: BIAGBHUIRSMWRI-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2S |
|---|---|
| Molecular weight | 211.16 g/mol |
| IUPAC name | 3,4,5-trifluorobenzenesulfonamide |
| InChIKey | BIAGBHUIRSMWRI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)S(=O)(=O)N |
Computed by PubChem (NCBI)