cas: 913472-55-6 — see every product listed under this CAS number, including other names
3,4,5-Trifluorobenzenesulfonamide (CAS 913472-55-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034669-1G |
| cas | 913472-55-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1414.10 Pln | |
| Fluorochem | 25g | 4923.28 Pln |
| delivery time | 2-3 weeks |
|---|
3,4,5-trifluorobenzenesulfonamide (CAS 913472-55-6) is a chemical compound with the molecular formula C6H4F3NO2S and a molecular weight of 211.16 g/mol. IUPAC name: 3,4,5-trifluorobenzenesulfonamide. InChIKey: BIAGBHUIRSMWRI-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NO2S |
|---|---|
| Molecular weight | 211.16 g/mol |
| IUPAC name | 3,4,5-trifluorobenzenesulfonamide |
| InChIKey | BIAGBHUIRSMWRI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)S(=O)(=O)N |
Computed by PubChem (NCBI)