cas: 5409-31-4 — see every product listed under this CAS number, including other names
3,4-Diethoxybenzoic acid, 97% (CAS 5409-31-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F319186-5G |
| cas | 5409-31-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 404.04 Pln | |
| Fluorochem | 250g | 919.49 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3,4-diethoxybenzoic acid (CAS 5409-31-4) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 3,4-diethoxybenzoic acid. InChIKey: VVKCVAPLTRZJHH-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 3,4-diethoxybenzoic acid |
| InChIKey | VVKCVAPLTRZJHH-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(=O)O)OCC |
Computed by PubChem (NCBI)