cas: 5409-31-4 — see every product listed under this CAS number, including other names
3,4-Diethoxybenzoic acid, 99% (CAS 5409-31-4) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 206170250 |
| cas | 5409-31-4 |
| size | 25g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 25g | 275.29 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
3,4-diethoxybenzoic acid (CAS 5409-31-4) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 3,4-diethoxybenzoic acid. InChIKey: VVKCVAPLTRZJHH-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 3,4-diethoxybenzoic acid |
| InChIKey | VVKCVAPLTRZJHH-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(=O)O)OCC |
Computed by PubChem (NCBI)