cas: 2244893-49-8 — see every product listed under this CAS number, including other names
3,4-Difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol 97% (CAS 2244893-49-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A472985-100mg |
| cas | 2244893-49-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 759.75 Pln | |
| Ambeed | 250mg | 1104.63 Pln | |
| Ambeed | 1g | 2567.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A472985 |
3,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 2244893-49-8) is a chemical compound with the molecular formula C12H15BF2O3 and a molecular weight of 256.06 g/mol. IUPAC name: 3,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: MRRIMYHDASDOCL-UHFFFAOYSA-N.
| Molecular formula | C12H15BF2O3 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 3,4-difluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | MRRIMYHDASDOCL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)F)O |
Computed by PubChem (NCBI)