cas: 107392-33-6 — see every product listed under this CAS number, including other names
3,4-Difluoro-benzamidine, HCl, 98%, 98% (CAS 107392-33-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118EHL-250mg |
| cas | 107392-33-6 |
| size | 250mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 520.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,4-difluorobenzenecarboximidamide;hydrochloride (CAS 107392-33-6) is a chemical compound with the molecular formula C7H7ClF2N2 and a molecular weight of 192.59 g/mol. IUPAC name: 3,4-difluorobenzenecarboximidamide;hydrochloride. InChIKey: WIFHYQZBCRLTBT-UHFFFAOYSA-N.
| Molecular formula | C7H7ClF2N2 |
|---|---|
| Molecular weight | 192.59 g/mol |
| IUPAC name | 3,4-difluorobenzenecarboximidamide;hydrochloride |
| InChIKey | WIFHYQZBCRLTBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=N)N)F)F.Cl |
Computed by PubChem (NCBI)